C24H30FN3O — CID 110140454
[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[5-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone (PubChem CID 110140454) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[5-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone.
| Compound Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[5-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140454 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[5-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone |
| SMILES | CN1CCCC[C@@H]2N(C(=O)c3cncc(Cc4cccc(F)c4)c3)CCC[C@@]21C |
| InChI | InChI=1S/C24H30FN3O/c1-24-10-6-12-28(22(24)9-3-4-11-27(24)2)23(29)20-14-19(16-26-17-20)13-18-7-5-8-21(25)15-18/h5,7-8,14-17,22H,3-4,6,9-13H2,1-2H3/t22-,24-/m0/s1 |
| InChIKey | JARWRXQXKYTYCK-UPVQGACJSA-N |
| XLogP | 4.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |