C20H26FN3O — CID 110133547
[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone (PubChem CID 110133547) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone.
| Compound Name | [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 110133547 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@@]3(C)[C@@H]2CCCN3C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H26FN3O/c1-13-15-12-14(21)7-8-16(15)22-18(13)19(25)24-11-5-9-20(2)17(24)6-4-10-23(20)3/h7-8,12,17,22H,4-6,9-11H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | YZIOXMHRGHXPHS-PXNSSMCTSA-N |
| XLogP | 3.70 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|