C25H28FN5O2 — CID 110084751
[2-[1-(5-fluoro-3-methyl-1H-indole-2-carbonyl)piperidin-3-yl]-4-methylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 110084751) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is [2-[1-(5-fluoro-3-methyl-1H-indole-2-carbonyl)piperidin-3-yl]-4-methylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-[1-(5-fluoro-3-methyl-1H-indole-2-carbonyl)piperidin-3-yl]-4-methylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 110084751 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [2-[1-(5-fluoro-3-methyl-1H-indole-2-carbonyl)piperidin-3-yl]-4-methylpyrimidin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1nc(C2CCCN(C(=O)c3[nH]c4ccc(F)cc4c3C)C2)ncc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C25H28FN5O2/c1-15-19-12-18(26)7-8-21(19)29-22(15)25(33)31-11-5-6-17(14-31)23-27-13-20(16(2)28-23)24(32)30-9-3-4-10-30/h7-8,12-13,17,29H,3-6,9-11,14H2,1-2H3 |
| InChIKey | WNKPOZUUCVUQLE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|