C25H29N5O3 — CID 127244608
(2,3-dimethyl-1H-indol-5-yl)-[3-[4-methyl-5-(morpholine-4-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 127244608) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[3-[4-methyl-5-(morpholine-4-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[3-[4-methyl-5-(morpholine-4-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 127244608 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[3-[4-methyl-5-(morpholine-4-carbonyl)pyrimidin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | Cc1nc(C2CCN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)C2)ncc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H29N5O3/c1-15-16(2)27-22-5-4-18(12-20(15)22)24(31)30-7-6-19(14-30)23-26-13-21(17(3)28-23)25(32)29-8-10-33-11-9-29/h4-5,12-13,19,27H,6-11,14H2,1-3H3 |
| InChIKey | GSLJULWVGHJGJJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|