C22H28N4O2 — CID 136765290
4-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepine-1-carbonyl]-2-phenyl-1H-pyrimidin-6-one (PubChem CID 136765290) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepine-1-carbonyl]-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepine-1-carbonyl]-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136765290 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepine-1-carbonyl]-2-phenyl-1H-pyrimidin-6-one |
| SMILES | CN1CCCC[C@@H]2N(C(=O)c3cc(=O)[nH]c(-c4ccccc4)n3)CCC[C@@]21C |
| InChI | InChI=1S/C22H28N4O2/c1-22-12-8-14-26(18(22)11-6-7-13-25(22)2)21(28)17-15-19(27)24-20(23-17)16-9-4-3-5-10-16/h3-5,9-10,15,18H,6-8,11-14H2,1-2H3,(H,23,24,27)/t18-,22-/m0/s1 |
| InChIKey | GSLDJXVATPZICA-AVRDEDQJSA-N |
| XLogP | 2.92 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |