C20H34N4O — CID 110141051
[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone (PubChem CID 110141051) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone.
| Compound Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 110141051 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
| SMILES | CC(C)Cc1cc(C(=O)N2CCC[C@@]3(C)[C@@H]2CCCCN3C)n(C)n1 |
| InChI | InChI=1S/C20H34N4O/c1-15(2)13-16-14-17(23(5)21-16)19(25)24-12-8-10-20(3)18(24)9-6-7-11-22(20)4/h14-15,18H,6-13H2,1-5H3/t18-,20-/m0/s1 |
| InChIKey | FIFFZUWOMVNXJZ-ICSRJNTNSA-N |
| XLogP | 3.10 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |