C19H30N4O — CID 110141066
[(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone (PubChem CID 110141066) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is [(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone.
| Compound Name | [(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 110141066 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(1S,4R,8S,9S)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-[1-methyl-3-(2-methylpropyl)pyrazol-5-yl]methanone |
| SMILES | CC(C)Cc1cc(C(=O)N2C[C@@H]3C[C@@]4(C)[C@H](CCC[C@@H]24)N3)n(C)n1 |
| InChI | InChI=1S/C19H30N4O/c1-12(2)8-13-9-15(22(4)21-13)18(24)23-11-14-10-19(3)16(20-14)6-5-7-17(19)23/h9,12,14,16-17,20H,5-8,10-11H2,1-4H3/t14-,16-,17+,19-/m0/s1 |
| InChIKey | VUTIVBJKHKGFJD-RMRDIRSESA-N |
| XLogP | 2.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |