C23H31N3OS — CID 110141282
[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-(2-benzyl-4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 110141282) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-(2-benzyl-4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-(2-benzyl-4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110141282 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-(2-benzyl-4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)N1CCC[C@@]2(C)[C@@H]1CCCCN2C |
| InChI | InChI=1S/C23H31N3OS/c1-17-21(28-20(24-17)16-18-10-5-4-6-11-18)22(27)26-15-9-13-23(2)19(26)12-7-8-14-25(23)3/h4-6,10-11,19H,7-9,12-16H2,1-3H3/t19-,23-/m0/s1 |
| InChIKey | PJAOZKJXKJQJHM-CVDCTZTESA-N |
| XLogP | 4.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |