C20H26N2OS — CID 55668344
2-benzyl-N-cycloheptyl-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 55668344) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-benzyl-N-cycloheptyl-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-cycloheptyl-N,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55668344 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-benzyl-N-cycloheptyl-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)N(C)C1CCCCCC1 |
| InChI | InChI=1S/C20H26N2OS/c1-15-19(20(23)22(2)17-12-8-3-4-9-13-17)24-18(21-15)14-16-10-6-5-7-11-16/h5-7,10-11,17H,3-4,8-9,12-14H2,1-2H3 |
| InChIKey | RXYICQWKPBDINM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |