C22H22N2OS — CID 55669656
N,2-dibenzyl-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide (PubChem CID 55669656) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is N,2-dibenzyl-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide.
| Compound Name | N,2-dibenzyl-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55669656 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N,2-dibenzyl-4-methyl-N-prop-2-enyl-1,3-thiazole-5-carboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)c1sc(Cc2ccccc2)nc1C |
| InChI | InChI=1S/C22H22N2OS/c1-3-14-24(16-19-12-8-5-9-13-19)22(25)21-17(2)23-20(26-21)15-18-10-6-4-7-11-18/h3-13H,1,14-16H2,2H3 |
| InChIKey | PPWPHWFRPGTSQT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|