C23H24N2O2S — CID 55917442
2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide (PubChem CID 55917442) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55917442 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H24N2O2S/c1-3-13-25(16-19-9-11-21(27-2)12-10-19)23(26)15-20-17-28-22(24-20)14-18-7-5-4-6-8-18/h3-12,17H,1,13-16H2,2H3 |
| InChIKey | KAWXMDKOJVYFQA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|