C20H19FN2OS2 — CID 86847886
2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 86847886) has the molecular formula C20H19FN2OS2 and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86847886 |
| Molecular Formula | C20H19FN2OS2 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methyl]-1,3-thiazol-4-yl]-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)Cc1csc(Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H19FN2OS2/c1-2-9-23(13-18-4-3-10-25-18)20(24)12-17-14-26-19(22-17)11-15-5-7-16(21)8-6-15/h2-8,10,14H,1,9,11-13H2 |
| InChIKey | ZUKMHCQQPHZZSW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|