C23H22N2OS — CID 48523916
2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylacetamide (PubChem CID 48523916) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 48523916 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCN(Cc1ccc(C)cc1)C(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H22N2OS/c1-3-13-25(16-20-11-9-18(2)10-12-20)23(26)15-21-17-27-22(24-21)14-19-7-5-4-6-8-19/h1,4-12,17H,13-16H2,2H3 |
| InChIKey | HNQNONKIOUNPNX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|