C25H22N2OS — CID 18209419
N-benzyl-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-N-phenylacetamide (PubChem CID 18209419) has the molecular formula C25H22N2OS and a molecular weight of 398.53 g/mol. Its IUPAC name is N-benzyl-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-N-phenylacetamide.
| Compound Name | N-benzyl-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 18209419 |
| Molecular Formula | C25H22N2OS |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-benzyl-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-N-phenylacetamide |
| SMILES | Cc1ccc(-c2nc(CC(=O)N(Cc3ccccc3)c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C25H22N2OS/c1-19-12-14-21(15-13-19)25-26-22(18-29-25)16-24(28)27(23-10-6-3-7-11-23)17-20-8-4-2-5-9-20/h2-15,18H,16-17H2,1H3 |
| InChIKey | YHMRARSBZDGOIP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |