C17H24N2OS — CID 143940536
N-benzyl-N-ethyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane (PubChem CID 143940536) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane.
| Compound Name | N-benzyl-N-ethyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143940536 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-benzyl-N-ethyl-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane |
| SMILES | CC.CCN(Cc1ccccc1)C(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C15H18N2OS.C2H6/c1-3-17(10-13-7-5-4-6-8-13)15(18)9-14-11-19-12(2)16-14;1-2/h4-8,11H,3,9-10H2,1-2H3;1-2H3 |
| InChIKey | ZJSVDZJOYFFOAL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |