C19H25N3OS — CID 71934858
N-cyclooctyl-N,4-dimethyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 71934858) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-cyclooctyl-N,4-dimethyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-cyclooctyl-N,4-dimethyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71934858 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-cyclooctyl-N,4-dimethyl-2-pyridin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)N(C)C1CCCCCCC1 |
| InChI | InChI=1S/C19H25N3OS/c1-14-17(24-18(21-14)16-12-8-9-13-20-16)19(23)22(2)15-10-6-4-3-5-7-11-15/h8-9,12-13,15H,3-7,10-11H2,1-2H3 |
| InChIKey | ABEPQUFCYZNFQK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |