C22H26N4O2 — CID 136866460
4-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecane-3-carbonyl]-2-phenyl-1H-pyrimidin-6-one (PubChem CID 136866460) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecane-3-carbonyl]-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecane-3-carbonyl]-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136866460 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecane-3-carbonyl]-2-phenyl-1H-pyrimidin-6-one |
| SMILES | CN1[C@@H]2CN(C(=O)c3cc(=O)[nH]c(-c4ccccc4)n3)[C@@H]3CCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C22H26N4O2/c1-22-12-15-13-26(18(22)10-6-9-17(22)25(15)2)21(28)16-11-19(27)24-20(23-16)14-7-4-3-5-8-14/h3-5,7-8,11,15,17-18H,6,9-10,12-13H2,1-2H3,(H,23,24,27)/t15-,17-,18+,22-/m0/s1 |
| InChIKey | LLZYDZZOTNLAOO-FCQWJQKHSA-N |
| XLogP | 2.52 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |