C20H30N4O — CID 110141151
1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-[methyl(pyridin-2-ylmethyl)amino]ethanone (PubChem CID 110141151) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-[methyl(pyridin-2-ylmethyl)amino]ethanone.
| Compound Name | 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-[methyl(pyridin-2-ylmethyl)amino]ethanone |
|---|---|
| PubChem CID | 110141151 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-[(1S,4R,8S,9S)-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-[methyl(pyridin-2-ylmethyl)amino]ethanone |
| SMILES | CN(CC(=O)N1C[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C)Cc1ccccn1 |
| InChI | InChI=1S/C20H30N4O/c1-20-11-16-13-24(18(20)9-6-8-17(20)23(16)3)19(25)14-22(2)12-15-7-4-5-10-21-15/h4-5,7,10,16-18H,6,8-9,11-14H2,1-3H3/t16-,17-,18+,20-/m0/s1 |
| InChIKey | CYTZCBLCOZBMDI-GNBUJSLZSA-N |
| XLogP | 1.99 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |