C18H25N3O — CID 110140579
[(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-pyridin-2-ylmethanone (PubChem CID 110140579) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110140579 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-pyridin-2-ylmethanone |
| SMILES | CN1[C@@H]2CN(C(=O)c3ccccn3)[C@@H]3CCCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C18H25N3O/c1-18-11-13-12-21(17(22)14-7-5-6-10-19-14)16(18)9-4-3-8-15(18)20(13)2/h5-7,10,13,15-16H,3-4,8-9,11-12H2,1-2H3/t13-,15-,16+,18-/m0/s1 |
| InChIKey | AIOVJGZEPQEGKO-SCNOPHJPSA-N |
| XLogP | 2.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |