C17H25N3O — CID 110141861
[(4aS,9aS)-1,4a-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-5-yl]-pyridin-2-ylmethanone (PubChem CID 110141861) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is [(4aS,9aS)-1,4a-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aS,9aS)-1,4a-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110141861 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [(4aS,9aS)-1,4a-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-5-yl]-pyridin-2-ylmethanone |
| SMILES | CN1CCC[C@@]2(C)[C@@H]1CCCCN2C(=O)c1ccccn1 |
| InChI | InChI=1S/C17H25N3O/c1-17-10-7-12-19(2)15(17)9-4-6-13-20(17)16(21)14-8-3-5-11-18-14/h3,5,8,11,15H,4,6-7,9-10,12-13H2,1-2H3/t15-,17-/m0/s1 |
| InChIKey | LTGPTOOOZLNDEM-RDJZCZTQSA-N |
| XLogP | 2.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |