C25H30FN3O — CID 110140482
[(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[6-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone (PubChem CID 110140482) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[6-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone.
| Compound Name | [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[6-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140482 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | [(1S,4R,9S,10S)-10,12-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[6-[(3-fluorophenyl)methyl]-3-pyridinyl]methanone |
| SMILES | CN1[C@@H]2CN(C(=O)c3ccc(Cc4cccc(F)c4)nc3)[C@@H]3CCCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C25H30FN3O/c1-25-14-21-16-29(23(25)9-4-3-8-22(25)28(21)2)24(30)18-10-11-20(27-15-18)13-17-6-5-7-19(26)12-17/h5-7,10-12,15,21-23H,3-4,8-9,13-14,16H2,1-2H3/t21-,22-,23+,25-/m0/s1 |
| InChIKey | GLMJGGGNIWHWHH-UCKMRUJXSA-N |
| XLogP | 4.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |