C25H26FN3O3 — CID 110094589
[2-[6-[(3-fluorophenyl)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone (PubChem CID 110094589) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is [2-[6-[(3-fluorophenyl)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | [2-[6-[(3-fluorophenyl)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 110094589 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [2-[6-[(3-fluorophenyl)methyl]pyrazin-2-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCCC2c2cncc(Cc3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C25H26FN3O3/c1-31-12-13-32-22-9-7-19(8-10-22)25(30)29-11-3-6-24(29)23-17-27-16-21(28-23)15-18-4-2-5-20(26)14-18/h2,4-5,7-10,14,16-17,24H,3,6,11-13,15H2,1H3 |
| InChIKey | XOTMBIXKPHYKJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|