C23H24N4O3 — CID 124961803
[4-(2-methoxyethoxy)phenyl]-[(2S)-2-(2-pyridin-2-ylpyrimidin-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 124961803) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)phenyl]-[(2S)-2-(2-pyridin-2-ylpyrimidin-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [4-(2-methoxyethoxy)phenyl]-[(2S)-2-(2-pyridin-2-ylpyrimidin-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124961803 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-(2-methoxyethoxy)phenyl]-[(2S)-2-(2-pyridin-2-ylpyrimidin-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCC[C@H]2c2ccnc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C23H24N4O3/c1-29-15-16-30-18-9-7-17(8-10-18)23(28)27-14-4-6-21(27)19-11-13-25-22(26-19)20-5-2-3-12-24-20/h2-3,5,7-13,21H,4,6,14-16H2,1H3/t21-/m0/s1 |
| InChIKey | HEHFFZMNVIRINJ-NRFANRHFSA-N |
| XLogP | 3.54 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|