C24H28FN3O2 — CID 110140487
1-[(4aR,8aS)-5-[6-[(2-fluorophenyl)methyl]pyridine-3-carbonyl]-8a-methyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone (PubChem CID 110140487) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[(4aR,8aS)-5-[6-[(2-fluorophenyl)methyl]pyridine-3-carbonyl]-8a-methyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-5-[6-[(2-fluorophenyl)methyl]pyridine-3-carbonyl]-8a-methyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 110140487 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[(4aR,8aS)-5-[6-[(2-fluorophenyl)methyl]pyridine-3-carbonyl]-8a-methyl-3,4,4a,6,7,8-hexahydro-2H-1,5-naphthyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H]2N(C(=O)c3ccc(Cc4ccccc4F)nc3)CCC[C@@]21C |
| InChI | InChI=1S/C24H28FN3O2/c1-17(29)28-14-5-9-22-24(28,2)12-6-13-27(22)23(30)19-10-11-20(26-16-19)15-18-7-3-4-8-21(18)25/h3-4,7-8,10-11,16,22H,5-6,9,12-15H2,1-2H3/t22-,24+/m1/s1 |
| InChIKey | LIRONERCGBIHBQ-VWNXMTODSA-N |
| XLogP | 3.82 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |