C22H31N5O — CID 110140427
[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[6-(2-ethylimidazol-1-yl)-3-pyridinyl]methanone (PubChem CID 110140427) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[6-(2-ethylimidazol-1-yl)-3-pyridinyl]methanone.
| Compound Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[6-(2-ethylimidazol-1-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140427 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | [(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-[6-(2-ethylimidazol-1-yl)-3-pyridinyl]methanone |
| SMILES | CCc1nccn1-c1ccc(C(=O)N2CCC[C@@]3(C)[C@@H]2CCCCN3C)cn1 |
| InChI | InChI=1S/C22H31N5O/c1-4-19-23-12-15-27(19)20-10-9-17(16-24-20)21(28)26-14-7-11-22(2)18(26)8-5-6-13-25(22)3/h9-10,12,15-16,18H,4-8,11,13-14H2,1-3H3/t18-,22-/m0/s1 |
| InChIKey | KBGKSEYWFMAGNK-AVRDEDQJSA-N |
| XLogP | 3.31 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |