C17H26N4O3 — CID 155901236
1-[2-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 155901236) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[2-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155901236 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[2-[(4aS,9aS)-4a,5-dimethyl-2,3,4,6,7,8,9,9a-octahydropyrido[3,2-b]azepin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CN1CCCC[C@@H]2N(C(=O)Cn3ccc(=O)[nH]c3=O)CCC[C@@]21C |
| InChI | InChI=1S/C17H26N4O3/c1-17-8-5-10-21(13(17)6-3-4-9-19(17)2)15(23)12-20-11-7-14(22)18-16(20)24/h7,11,13H,3-6,8-10,12H2,1-2H3,(H,18,22,24)/t13-,17-/m0/s1 |
| InChIKey | DXPIGQMPQQJTRJ-GUYCJALGSA-N |
| XLogP | 0.40 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |