C20H28N2O2 — CID 110140228
[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(2-methoxyphenyl)methanone (PubChem CID 110140228) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 110140228 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1[C@@H]2CN(C)[C@@H]3CCCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C20H28N2O2/c1-20-12-14-13-21(2)17(20)10-6-7-11-18(20)22(14)19(23)15-8-4-5-9-16(15)24-3/h4-5,8-9,14,17-18H,6-7,10-13H2,1-3H3/t14-,17+,18-,20+/m0/s1 |
| InChIKey | HFQGQRNBFFCCON-XBQLCILLSA-N |
| XLogP | 3.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |