C22H33N5O2 — CID 110141647
[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methanone (PubChem CID 110141647) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methanone.
| Compound Name | [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 110141647 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | [(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2[C@@H]3CN(C)[C@@H]4CCCC[C@H]2[C@]4(C)C3)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H33N5O2/c1-15-12-17(24-21(23-15)26-8-10-29-11-9-26)20(28)27-16-13-22(2)18(25(3)14-16)6-4-5-7-19(22)27/h12,16,18-19H,4-11,13-14H2,1-3H3/t16-,18+,19-,22+/m0/s1 |
| InChIKey | IGZKLKWMGXJJLB-YNFBMLRVSA-N |
| XLogP | 2.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |