C18H26N4O3 — CID 110141088
N-[2-[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide (PubChem CID 110141088) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[2-[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-[2-[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 110141088 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[2-[(4aS,8aS)-4a,5-dimethyl-3,4,6,7,8,8a-hexahydro-2H-1,5-naphthyridin-1-yl]-2-oxoethyl]-5-hydroxypyridine-3-carboxamide |
| SMILES | CN1CCC[C@@H]2N(C(=O)CNC(=O)c3cncc(O)c3)CCC[C@@]21C |
| InChI | InChI=1S/C18H26N4O3/c1-18-6-4-8-22(15(18)5-3-7-21(18)2)16(24)12-20-17(25)13-9-14(23)11-19-10-13/h9-11,15,23H,3-8,12H2,1-2H3,(H,20,25)/t15-,18-/m0/s1 |
| InChIKey | RIGVLYMQWRIXEK-YJBOKZPZSA-N |
| XLogP | 0.99 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |