C20H22FN3O2 — CID 110090407
1-[2-[(3-fluorophenyl)methyl]pyridine-4-carbonyl]-4-methylpiperidine-4-carboxamide (PubChem CID 110090407) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[2-[(3-fluorophenyl)methyl]pyridine-4-carbonyl]-4-methylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(3-fluorophenyl)methyl]pyridine-4-carbonyl]-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 110090407 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[2-[(3-fluorophenyl)methyl]pyridine-4-carbonyl]-4-methylpiperidine-4-carboxamide |
| SMILES | CC1(C(N)=O)CCN(C(=O)c2ccnc(Cc3cccc(F)c3)c2)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c1-20(19(22)26)6-9-24(10-7-20)18(25)15-5-8-23-17(13-15)12-14-3-2-4-16(21)11-14/h2-5,8,11,13H,6-7,9-10,12H2,1H3,(H2,22,26) |
| InChIKey | WNRSYLZDMCFUFO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |