C12H22N2O2 — CID 110138296
1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-methoxyethanone (PubChem CID 110138296) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 110138296 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC[C@]2(C)NCCC[C@@H]12 |
| InChI | InChI=1S/C12H22N2O2/c1-12-6-4-8-14(11(15)9-16-2)10(12)5-3-7-13-12/h10,13H,3-9H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | AXPNRFTVDNILLD-PWSUYJOCSA-N |
| XLogP | 0.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |