C19H28N2O3 — CID 110140771
1-[(4aS,9aS)-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 110140771) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[(4aS,9aS)-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(4aS,9aS)-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 110140771 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[(4aS,9aS)-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccccc1OCC(=O)N1CCC[C@]2(C)NCCCC[C@H]12 |
| InChI | InChI=1S/C19H28N2O3/c1-19-11-7-13-21(17(19)10-5-6-12-20-19)18(22)14-24-16-9-4-3-8-15(16)23-2/h3-4,8-9,17,20H,5-7,10-14H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | ZFCCBWZATIJAPB-HKUYNNGSSA-N |
| XLogP | 2.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |