C20H26N2O3 — CID 110142093
1-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-phenoxyethanone (PubChem CID 110142093) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110142093 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-phenoxyethanone |
| SMILES | CC(=O)N1C[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C(=O)COc1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-14(23)21-12-15-11-20(2)17(21)9-6-10-18(20)22(15)19(24)13-25-16-7-4-3-5-8-16/h3-5,7-8,15,17-18H,6,9-13H2,1-2H3/t15-,17+,18-,20+/m0/s1 |
| InChIKey | DLSGECMFRZWDRX-ZNWBIBPKSA-N |
| XLogP | 2.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |