C22H28N4O3 — CID 110142056
1-[2-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one (PubChem CID 110142056) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[2-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one.
| Compound Name | 1-[2-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 110142056 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[2-[(1S,4R,8S,9R)-3-acetyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-3-methylbenzimidazol-2-one |
| SMILES | CC(=O)N1C[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C(=O)Cn1c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C22H28N4O3/c1-14(27)24-12-15-11-22(2)18(24)9-6-10-19(22)26(15)20(28)13-25-17-8-5-4-7-16(17)23(3)21(25)29/h4-5,7-8,15,18-19H,6,9-13H2,1-3H3/t15-,18+,19-,22+/m0/s1 |
| InChIKey | OMVNKJVWFBAIIE-TUXJCPBXSA-N |
| XLogP | 1.73 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |