C27H30N4OS — CID 110140407
[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone (PubChem CID 110140407) has the molecular formula C27H30N4OS and a molecular weight of 458.63 g/mol. Its IUPAC name is [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone.
| Compound Name | [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140407 |
| Molecular Formula | C27H30N4OS |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone |
| SMILES | C[C@]12C[C@@H]3N[C@H]1CCCC[C@H]2N(C(=O)c1cccnc1-c1cncs1)[C@H]3Cc1ccccc1 |
| InChI | InChI=1S/C27H30N4OS/c1-27-15-20-21(14-18-8-3-2-4-9-18)31(24(27)12-6-5-11-23(27)30-20)26(32)19-10-7-13-29-25(19)22-16-28-17-33-22/h2-4,7-10,13,16-17,20-21,23-24,30H,5-6,11-12,14-15H2,1H3/t20-,21-,23-,24+,27-/m0/s1 |
| InChIKey | ZDAJBJUOLCTGPA-LKCOVVFOSA-N |
| XLogP | 4.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |