C23H30N4O — CID 110141424
1-[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-2-pyrazol-1-ylethanone (PubChem CID 110141424) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 110141424 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-2-pyrazol-1-ylethanone |
| SMILES | C[C@]12C[C@@H]3N[C@H]1CCCC[C@H]2N(C(=O)Cn1cccn1)[C@H]3Cc1ccccc1 |
| InChI | InChI=1S/C23H30N4O/c1-23-15-18-19(14-17-8-3-2-4-9-17)27(22(28)16-26-13-7-12-24-26)21(23)11-6-5-10-20(23)25-18/h2-4,7-9,12-13,18-21,25H,5-6,10-11,14-16H2,1H3/t18-,19-,20-,21+,23-/m0/s1 |
| InChIKey | PHTYTUSYHZXTFW-XANJAXJYSA-N |
| XLogP | 3.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |