C23H27N3O — CID 110140119
[(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyridin-3-ylmethanone (PubChem CID 110140119) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110140119 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | [(1S,2S,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyridin-3-ylmethanone |
| SMILES | C[C@]12C[C@@H]3N[C@H]1CCC[C@H]2N(C(=O)c1cccnc1)[C@H]3Cc1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-23-14-18-19(13-16-7-3-2-4-8-16)26(21(23)11-5-10-20(23)25-18)22(27)17-9-6-12-24-15-17/h2-4,6-9,12,15,18-21,25H,5,10-11,13-14H2,1H3/t18-,19-,20-,21+,23-/m0/s1 |
| InChIKey | YXCPHPSZBRYBLI-XANJAXJYSA-N |
| XLogP | 3.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |