C28H31N3O — CID 129454021
[(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-isoquinolin-1-ylmethanone (PubChem CID 129454021) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 129454021 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-isoquinolin-1-ylmethanone |
| SMILES | C[C@@]12C[C@H]3[C@@H](Cc4ccccc4)N[C@@H]1CCCC[C@@H]2N3C(=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C28H31N3O/c1-28-18-23-22(17-19-9-3-2-4-10-19)30-24(28)13-7-8-14-25(28)31(23)27(32)26-21-12-6-5-11-20(21)15-16-29-26/h2-6,9-12,15-16,22-25,30H,7-8,13-14,17-18H2,1H3/t22-,23+,24-,25+,28-/m1/s1 |
| InChIKey | CNFICXVSMRJBBD-KAUKRTNFSA-N |
| XLogP | 4.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |