C23H28N4O — CID 110140132
[(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyrazin-2-ylmethanone (PubChem CID 110140132) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 110140132 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(1S,2R,4R,9S,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyrazin-2-ylmethanone |
| SMILES | C[C@@]12C[C@H]3[C@@H](Cc4ccccc4)N[C@@H]1CCCC[C@@H]2N3C(=O)c1cnccn1 |
| InChI | InChI=1S/C23H28N4O/c1-23-14-19-17(13-16-7-3-2-4-8-16)26-20(23)9-5-6-10-21(23)27(19)22(28)18-15-24-11-12-25-18/h2-4,7-8,11-12,15,17,19-21,26H,5-6,9-10,13-14H2,1H3/t17-,19+,20-,21+,23-/m1/s1 |
| InChIKey | KDRXAZUDXFCOGG-JOLONKIQSA-N |
| XLogP | 3.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |