C22H26N4O — CID 110141755
[(1S,2R,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyrimidin-2-ylmethanone (PubChem CID 110141755) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is [(1S,2R,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [(1S,2R,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 110141755 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1S,2R,4R,8S,9S)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-pyrimidin-2-ylmethanone |
| SMILES | C[C@]12C[C@@H]3N[C@H]1CCC[C@H]2N(C(=O)c1ncccn1)[C@@H]3Cc1ccccc1 |
| InChI | InChI=1S/C22H26N4O/c1-22-14-16-17(13-15-7-3-2-4-8-15)26(19(22)10-5-9-18(22)25-16)21(27)20-23-11-6-12-24-20/h2-4,6-8,11-12,16-19,25H,5,9-10,13-14H2,1H3/t16-,17+,18-,19+,22-/m0/s1 |
| InChIKey | CSMBTALQYHPSBQ-XTCYKFNRSA-N |
| XLogP | 2.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |