C23H30ClN3OS — CID 171687422
[(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride (PubChem CID 171687422) has the molecular formula C23H30ClN3OS and a molecular weight of 432.03 g/mol. Its IUPAC name is [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride.
| Compound Name | [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171687422 |
| Molecular Formula | C23H30ClN3OS |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(1S,2S,4R,9S,10S)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]-(4-methyl-1,3-thiazol-5-yl)methanone;hydrochloride |
| SMILES | Cc1ncsc1C(=O)N1[C@@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCCC[C@@H]13)N2.Cl |
| InChI | InChI=1S/C23H29N3OS.ClH/c1-15-21(28-14-24-15)22(27)26-18(12-16-8-4-3-5-9-16)17-13-23(2)19(25-17)10-6-7-11-20(23)26;/h3-5,8-9,14,17-20,25H,6-7,10-13H2,1-2H3;1H/t17-,18-,19-,20+,23-;/m0./s1 |
| InChIKey | GCNHSEOFHRLBSM-SCXFFXLLSA-N |
| XLogP | 4.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |