C25H31NO3 — CID 171959646
tert-butyl 3-hydroxy-3-[(4-phenylphenyl)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171959646) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-[(4-phenylphenyl)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-[(4-phenylphenyl)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171959646 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl 3-hydroxy-3-[(4-phenylphenyl)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(O)(Cc1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C25H31NO3/c1-24(2,3)29-23(27)26-21-13-14-22(26)17-25(28,16-21)15-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,21-22,28H,13-17H2,1-3H3 |
| InChIKey | UYSSUCQXGIIQDC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |