C25H31NO2 — CID 25140532
tert-butyl (3aS,6aR)-6a-[(4-phenylphenyl)methyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole-1-carboxylate (PubChem CID 25140532) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-6a-[(4-phenylphenyl)methyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-6a-[(4-phenylphenyl)methyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 25140532 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl (3aS,6aR)-6a-[(4-phenylphenyl)methyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CCC[C@@]21Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H31NO2/c1-24(2,3)28-23(27)26-17-15-22-10-7-16-25(22,26)18-19-11-13-21(14-12-19)20-8-5-4-6-9-20/h4-6,8-9,11-14,22H,7,10,15-18H2,1-3H3/t22-,25+/m0/s1 |
| InChIKey | NETXRFKENLWXOY-WIOPSUGQSA-N |
| XLogP | 6.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |