C20H29NO3 — CID 56927461
tert-butyl (3aS,7aS)-7a-benzyl-1-hydroxy-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carboxylate (PubChem CID 56927461) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl (3aS,7aS)-7a-benzyl-1-hydroxy-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,7aS)-7a-benzyl-1-hydroxy-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 56927461 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl (3aS,7aS)-7a-benzyl-1-hydroxy-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CCCC[C@@]2(Cc2ccccc2)C1O |
| InChI | InChI=1S/C20H29NO3/c1-19(2,3)24-18(23)21-14-16-11-7-8-12-20(16,17(21)22)13-15-9-5-4-6-10-15/h4-6,9-10,16-17,22H,7-8,11-14H2,1-3H3/t16-,17?,20+/m1/s1 |
| InChIKey | GFVNQLNKZSWXFL-ZYLKAMJESA-N |
| XLogP | 3.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |