C16H21NO3 — CID 175304795
tert-butyl 3-benzyl-3-hydroxy-2H-pyrrole-1-carboxylate (PubChem CID 175304795) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl 3-benzyl-3-hydroxy-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 3-benzyl-3-hydroxy-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 175304795 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | tert-butyl 3-benzyl-3-hydroxy-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(O)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H21NO3/c1-15(2,3)20-14(18)17-10-9-16(19,12-17)11-13-7-5-4-6-8-13/h4-10,19H,11-12H2,1-3H3 |
| InChIKey | GTJNKSLEEMUJOI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |