C25H38N2O5 — CID 110153431
tert-butyl (2R,3aR,4S,8aR)-4-hydroxy-2-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate (PubChem CID 110153431) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl (2R,3aR,4S,8aR)-4-hydroxy-2-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2R,3aR,4S,8aR)-4-hydroxy-2-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 110153431 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | tert-butyl (2R,3aR,4S,8aR)-4-hydroxy-2-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate |
| SMILES | COc1ccccc1CC(=O)NC[C@H]1C[C@@]2(C)[C@@H](O)CCCC[C@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H38N2O5/c1-24(2,3)32-23(30)27-18(15-25(4)20(27)12-8-9-13-21(25)28)16-26-22(29)14-17-10-6-7-11-19(17)31-5/h6-7,10-11,18,20-21,28H,8-9,12-16H2,1-5H3,(H,26,29)/t18-,20-,21+,25-/m1/s1 |
| InChIKey | JEBPJTQDFRWDNH-MASGSYHESA-N |
| XLogP | 3.67 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |