C23H33NO4 — CID 110153677
1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 110153677) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 110153677 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | C[C@@]12C[C@H](c3ccccc3)N(C(=O)CC3CCOCC3)[C@@H]1CCC[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C23H33NO4/c1-23-15-18(17-6-3-2-4-7-17)24(20(23)9-5-8-19(25)22(23)27)21(26)14-16-10-12-28-13-11-16/h2-4,6-7,16,18-20,22,25,27H,5,8-15H2,1H3/t18-,19+,20-,22+,23-/m1/s1 |
| InChIKey | SZUAMXXXCNRFND-NJRJFZHGSA-N |
| XLogP | 3.06 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |