C22H27N3O — CID 110137331
[(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-pyridin-4-ylmethanone (PubChem CID 110137331) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110137331 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [(2S,3aS,9aS)-3a-methyl-2-phenyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-1-yl]-pyridin-4-ylmethanone |
| SMILES | C[C@]12C[C@@H](c3ccccc3)N(C(=O)c3ccncc3)[C@H]1CCCCCN2 |
| InChI | InChI=1S/C22H27N3O/c1-22-16-19(17-8-4-2-5-9-17)25(20(22)10-6-3-7-13-24-22)21(26)18-11-14-23-15-12-18/h2,4-5,8-9,11-12,14-15,19-20,24H,3,6-7,10,13,16H2,1H3/t19-,20-,22-/m0/s1 |
| InChIKey | GWDGHMMAZNUDLI-ONTIZHBOSA-N |
| XLogP | 3.96 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |