C20H23N3O — CID 110137413
[(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-pyridin-3-ylmethanone (PubChem CID 110137413) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110137413 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1[C@H](c2ccccc2)C[C@H]2NCCCC[C@@H]21 |
| InChI | InChI=1S/C20H23N3O/c24-20(16-9-6-11-21-14-16)23-18-10-4-5-12-22-17(18)13-19(23)15-7-2-1-3-8-15/h1-3,6-9,11,14,17-19,22H,4-5,10,12-13H2/t17-,18+,19+/m1/s1 |
| InChIKey | XAZXRSCWDVUNIT-QYZOEREBSA-N |
| XLogP | 3.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |