C19H19FN2O — CID 16674981
[3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-pyridin-3-ylmethanone (PubChem CID 16674981) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-pyridin-3-ylmethanone.
| Compound Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 16674981 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1C2CCC1CC(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C19H19FN2O/c20-16-5-3-13(4-6-16)15-10-17-7-8-18(11-15)22(17)19(23)14-2-1-9-21-12-14/h1-6,9,12,15,17-18H,7-8,10-11H2 |
| InChIKey | QTOQEDWNWYAQFX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |